C27H50N4O3Si — CID 169222813
5-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]aniline (PubChem CID 169222813) has the molecular formula C27H50N4O3Si and a molecular weight of 506.81 g/mol. Its IUPAC name is 5-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]aniline.
| Compound Name | 5-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]aniline |
|---|---|
| PubChem CID | 169222813 |
| Molecular Formula | C27H50N4O3Si |
| Molecular Weight | 506.81 g/mol |
| Exact Mass | 506.37 |
| IUPAC Name | 5-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]aniline |
| SMILES | COc1cc(N2CCC(N3CCN(C)CC3)CC2)c(OCCCCO[Si](C)(C)C(C)(C)C)cc1N |
| InChI | InChI=1S/C27H50N4O3Si/c1-27(2,3)35(6,7)34-19-9-8-18-33-26-20-23(28)25(32-5)21-24(26)31-12-10-22(11-13-31)30-16-14-29(4)15-17-30/h20-22H,8-19,28H2,1-7H3 |
| InChIKey | UIVKLTNTLKFWAQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.81 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|