C21H34N4O — CID 177085199
5-ethyl-2-methoxy-4-[4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)piperidin-1-yl]aniline (PubChem CID 177085199) has the molecular formula C21H34N4O and a molecular weight of 358.53 g/mol. Its IUPAC name is 5-ethyl-2-methoxy-4-[4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)piperidin-1-yl]aniline.
| Compound Name | 5-ethyl-2-methoxy-4-[4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)piperidin-1-yl]aniline |
|---|---|
| PubChem CID | 177085199 |
| Molecular Formula | C21H34N4O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 5-ethyl-2-methoxy-4-[4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)piperidin-1-yl]aniline |
| SMILES | CCc1cc(N)c(OC)cc1N1CCC(N2CC3CCC(C2)N3C)CC1 |
| InChI | InChI=1S/C21H34N4O/c1-4-15-11-19(22)21(26-3)12-20(15)24-9-7-16(8-10-24)25-13-17-5-6-18(14-25)23(17)2/h11-12,16-18H,4-10,13-14,22H2,1-3H3 |
| InChIKey | PLGUIAYKISNIQK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 44.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|