C19H31N3O3 — CID 171491758
tert-butyl N-[1-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-4-yl]carbamate (PubChem CID 171491758) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is tert-butyl N-[1-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 171491758 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | tert-butyl N-[1-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-4-yl]carbamate |
| SMILES | CCc1cc(N)c(OC)cc1N1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H31N3O3/c1-6-13-11-15(20)17(24-5)12-16(13)22-9-7-14(8-10-22)21-18(23)25-19(2,3)4/h11-12,14H,6-10,20H2,1-5H3,(H,21,23) |
| InChIKey | KTLXEIMFWSDEEK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|