C15H24N4O3 — CID 133492699
tert-butyl N-[(3R)-1-(6-ethoxypyrimidin-4-yl)pyrrolidin-3-yl]carbamate (PubChem CID 133492699) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(6-ethoxypyrimidin-4-yl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(6-ethoxypyrimidin-4-yl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 133492699 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | tert-butyl N-[(3R)-1-(6-ethoxypyrimidin-4-yl)pyrrolidin-3-yl]carbamate |
| SMILES | CCOc1cc(N2CC[C@@H](NC(=O)OC(C)(C)C)C2)ncn1 |
| InChI | InChI=1S/C15H24N4O3/c1-5-21-13-8-12(16-10-17-13)19-7-6-11(9-19)18-14(20)22-15(2,3)4/h8,10-11H,5-7,9H2,1-4H3,(H,18,20)/t11-/m1/s1 |
| InChIKey | QQODRMCSXFEJHE-LLVKDONJSA-N |
| XLogP | 1.98 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |