C17H27N5O2 — CID 86331531
tert-butyl N-[(3R)-1-[6-(cyclopropylamino)pyrimidin-4-yl]piperidin-3-yl]carbamate (PubChem CID 86331531) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[6-(cyclopropylamino)pyrimidin-4-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[6-(cyclopropylamino)pyrimidin-4-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86331531 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | tert-butyl N-[(3R)-1-[6-(cyclopropylamino)pyrimidin-4-yl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCN(c2cc(NC3CC3)ncn2)C1 |
| InChI | InChI=1S/C17H27N5O2/c1-17(2,3)24-16(23)21-13-5-4-8-22(10-13)15-9-14(18-11-19-15)20-12-6-7-12/h9,11-13H,4-8,10H2,1-3H3,(H,21,23)(H,18,19,20)/t13-/m1/s1 |
| InChIKey | JQTFQIXIMFJILI-CYBMUJFWSA-N |
| XLogP | 2.54 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |