C18H24N4O2S — CID 126849919
tert-butyl N-[1-(6-thiophen-2-ylpyrimidin-4-yl)piperidin-3-yl]carbamate (PubChem CID 126849919) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is tert-butyl N-[1-(6-thiophen-2-ylpyrimidin-4-yl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(6-thiophen-2-ylpyrimidin-4-yl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 126849919 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | tert-butyl N-[1-(6-thiophen-2-ylpyrimidin-4-yl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(c2cc(-c3cccs3)ncn2)C1 |
| InChI | InChI=1S/C18H24N4O2S/c1-18(2,3)24-17(23)21-13-6-4-8-22(11-13)16-10-14(19-12-20-16)15-7-5-9-25-15/h5,7,9-10,12-13H,4,6,8,11H2,1-3H3,(H,21,23) |
| InChIKey | MWDHBXFKBQRBFW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |