C18H30N4O2 — CID 126849999
tert-butyl N-[1-(6-tert-butylpyrimidin-4-yl)piperidin-3-yl]carbamate (PubChem CID 126849999) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl N-[1-(6-tert-butylpyrimidin-4-yl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(6-tert-butylpyrimidin-4-yl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 126849999 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | tert-butyl N-[1-(6-tert-butylpyrimidin-4-yl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(c2cc(C(C)(C)C)ncn2)C1 |
| InChI | InChI=1S/C18H30N4O2/c1-17(2,3)14-10-15(20-12-19-14)22-9-7-8-13(11-22)21-16(23)24-18(4,5)6/h10,12-13H,7-9,11H2,1-6H3,(H,21,23) |
| InChIKey | ASXGUHAUBBPHSI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |