C16H28N4O4 — CID 58853857
tert-butyl N-[(3R)-1-[5-(dimethoxymethyl)-1H-pyrazol-3-yl]piperidin-3-yl]carbamate (PubChem CID 58853857) has the molecular formula C16H28N4O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[5-(dimethoxymethyl)-1H-pyrazol-3-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[5-(dimethoxymethyl)-1H-pyrazol-3-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 58853857 |
| Molecular Formula | C16H28N4O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | tert-butyl N-[(3R)-1-[5-(dimethoxymethyl)-1H-pyrazol-3-yl]piperidin-3-yl]carbamate |
| SMILES | COC(OC)c1cc(N2CCC[C@@H](NC(=O)OC(C)(C)C)C2)n[nH]1 |
| InChI | InChI=1S/C16H28N4O4/c1-16(2,3)24-15(21)17-11-7-6-8-20(10-11)13-9-12(18-19-13)14(22-4)23-5/h9,11,14H,6-8,10H2,1-5H3,(H,17,21)(H,18,19)/t11-/m1/s1 |
| InChIKey | PUYOWJHXFKZNTN-LLVKDONJSA-N |
| XLogP | 2.19 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|