C15H22F2N4O2 — CID 126850026
tert-butyl N-[1-[6-(difluoromethyl)pyrimidin-4-yl]piperidin-3-yl]carbamate (PubChem CID 126850026) has the molecular formula C15H22F2N4O2 and a molecular weight of 328.36 g/mol. Its IUPAC name is tert-butyl N-[1-[6-(difluoromethyl)pyrimidin-4-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[6-(difluoromethyl)pyrimidin-4-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 126850026 |
| Molecular Formula | C15H22F2N4O2 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | tert-butyl N-[1-[6-(difluoromethyl)pyrimidin-4-yl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(c2cc(C(F)F)ncn2)C1 |
| InChI | InChI=1S/C15H22F2N4O2/c1-15(2,3)23-14(22)20-10-5-4-6-21(8-10)12-7-11(13(16)17)18-9-19-12/h7,9-10,13H,4-6,8H2,1-3H3,(H,20,22) |
| InChIKey | AKOAIQKZEZRYRC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |