C16H24BrN3O2 — CID 169408081
tert-butyl N-[(3R)-1-(5-bromo-4-methyl-2-pyridinyl)piperidin-3-yl]carbamate (PubChem CID 169408081) has the molecular formula C16H24BrN3O2 and a molecular weight of 370.29 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(5-bromo-4-methyl-2-pyridinyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(5-bromo-4-methyl-2-pyridinyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 169408081 |
| Molecular Formula | C16H24BrN3O2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | tert-butyl N-[(3R)-1-(5-bromo-4-methyl-2-pyridinyl)piperidin-3-yl]carbamate |
| SMILES | Cc1cc(N2CCC[C@@H](NC(=O)OC(C)(C)C)C2)ncc1Br |
| InChI | InChI=1S/C16H24BrN3O2/c1-11-8-14(18-9-13(11)17)20-7-5-6-12(10-20)19-15(21)22-16(2,3)4/h8-9,12H,5-7,10H2,1-4H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | JEFOBOPJURHPCG-GFCCVEGCSA-N |
| XLogP | 3.65 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |