C14H22N4O3 — CID 165437493
tert-butyl N-[1-(5-hydroxypyrimidin-2-yl)piperidin-3-yl]carbamate (PubChem CID 165437493) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is tert-butyl N-[1-(5-hydroxypyrimidin-2-yl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(5-hydroxypyrimidin-2-yl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 165437493 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | tert-butyl N-[1-(5-hydroxypyrimidin-2-yl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(c2ncc(O)cn2)C1 |
| InChI | InChI=1S/C14H22N4O3/c1-14(2,3)21-13(20)17-10-5-4-6-18(9-10)12-15-7-11(19)8-16-12/h7-8,10,19H,4-6,9H2,1-3H3,(H,17,20) |
| InChIKey | DJWOAYOOGVZWTE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |