C17H29N5O2 — CID 133299291
tert-butyl N-[2-[[6-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]ethyl]carbamate (PubChem CID 133299291) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl N-[2-[[6-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[6-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 133299291 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | tert-butyl N-[2-[[6-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]ethyl]carbamate |
| SMILES | CC1CCCN(c2cc(NCCNC(=O)OC(C)(C)C)ncn2)C1 |
| InChI | InChI=1S/C17H29N5O2/c1-13-6-5-9-22(11-13)15-10-14(20-12-21-15)18-7-8-19-16(23)24-17(2,3)4/h10,12-13H,5-9,11H2,1-4H3,(H,19,23)(H,18,20,21) |
| InChIKey | MTZFPAZHOZAUFP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|