C17H28N4O3 — CID 126850102
tert-butyl N-[1-[6-(2-methoxyethyl)pyrimidin-4-yl]piperidin-4-yl]carbamate (PubChem CID 126850102) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is tert-butyl N-[1-[6-(2-methoxyethyl)pyrimidin-4-yl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[6-(2-methoxyethyl)pyrimidin-4-yl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 126850102 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | tert-butyl N-[1-[6-(2-methoxyethyl)pyrimidin-4-yl]piperidin-4-yl]carbamate |
| SMILES | COCCc1cc(N2CCC(NC(=O)OC(C)(C)C)CC2)ncn1 |
| InChI | InChI=1S/C17H28N4O3/c1-17(2,3)24-16(22)20-13-5-8-21(9-6-13)15-11-14(7-10-23-4)18-12-19-15/h11-13H,5-10H2,1-4H3,(H,20,22) |
| InChIKey | XYSMGCMNVPEERN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |