C23H37FN4O3 — CID 170953965
tert-butyl N-[4-[[4-(4-amino-2-fluoro-5-methoxyphenyl)piperazin-1-yl]methyl]cyclohexyl]carbamate (PubChem CID 170953965) has the molecular formula C23H37FN4O3 and a molecular weight of 436.57 g/mol. Its IUPAC name is tert-butyl N-[4-[[4-(4-amino-2-fluoro-5-methoxyphenyl)piperazin-1-yl]methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[4-(4-amino-2-fluoro-5-methoxyphenyl)piperazin-1-yl]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 170953965 |
| Molecular Formula | C23H37FN4O3 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | tert-butyl N-[4-[[4-(4-amino-2-fluoro-5-methoxyphenyl)piperazin-1-yl]methyl]cyclohexyl]carbamate |
| SMILES | COc1cc(N2CCN(CC3CCC(NC(=O)OC(C)(C)C)CC3)CC2)c(F)cc1N |
| InChI | InChI=1S/C23H37FN4O3/c1-23(2,3)31-22(29)26-17-7-5-16(6-8-17)15-27-9-11-28(12-10-27)20-14-21(30-4)19(25)13-18(20)24/h13-14,16-17H,5-12,15,25H2,1-4H3,(H,26,29) |
| InChIKey | UUPNPQNLOAQRNG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|