C22H36N4O3 — CID 171474596
tert-butyl 4-[[4-(4-amino-2-methoxyphenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 171474596) has the molecular formula C22H36N4O3 and a molecular weight of 404.56 g/mol. Its IUPAC name is tert-butyl 4-[[4-(4-amino-2-methoxyphenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(4-amino-2-methoxyphenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171474596 |
| Molecular Formula | C22H36N4O3 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | tert-butyl 4-[[4-(4-amino-2-methoxyphenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | COc1cc(N)ccc1N1CCN(CC2CCN(C(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C22H36N4O3/c1-22(2,3)29-21(27)26-9-7-17(8-10-26)16-24-11-13-25(14-12-24)19-6-5-18(23)15-20(19)28-4/h5-6,15,17H,7-14,16,23H2,1-4H3 |
| InChIKey | HJMFOTFNYOJDKQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 71.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|