C21H34N2O4 — CID 139421073
tert-butyl 5-[2-(4-amino-2-methoxyphenoxy)ethyl]azocane-1-carboxylate (PubChem CID 139421073) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is tert-butyl 5-[2-(4-amino-2-methoxyphenoxy)ethyl]azocane-1-carboxylate.
| Compound Name | tert-butyl 5-[2-(4-amino-2-methoxyphenoxy)ethyl]azocane-1-carboxylate |
|---|---|
| PubChem CID | 139421073 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | tert-butyl 5-[2-(4-amino-2-methoxyphenoxy)ethyl]azocane-1-carboxylate |
| SMILES | COc1cc(N)ccc1OCCC1CCCN(C(=O)OC(C)(C)C)CCC1 |
| InChI | InChI=1S/C21H34N2O4/c1-21(2,3)27-20(24)23-12-5-7-16(8-6-13-23)11-14-26-18-10-9-17(22)15-19(18)25-4/h9-10,15-16H,5-8,11-14,22H2,1-4H3 |
| InChIKey | IEYCVRFSFYPOIG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|