C21H30N2O5 — CID 151002696
tert-butyl 4-[2-(4-nitro-2-prop-1-en-2-ylphenoxy)ethyl]piperidine-1-carboxylate (PubChem CID 151002696) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-nitro-2-prop-1-en-2-ylphenoxy)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-nitro-2-prop-1-en-2-ylphenoxy)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 151002696 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | tert-butyl 4-[2-(4-nitro-2-prop-1-en-2-ylphenoxy)ethyl]piperidine-1-carboxylate |
| SMILES | C=C(C)c1cc([N+](=O)[O-])ccc1OCCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H30N2O5/c1-15(2)18-14-17(23(25)26)6-7-19(18)27-13-10-16-8-11-22(12-9-16)20(24)28-21(3,4)5/h6-7,14,16H,1,8-13H2,2-5H3 |
| InChIKey | LULFGCMXERGJAD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|