About 2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate
2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate (PubChem CID 178001694) has the molecular formula C19H29BrN2O5Si
and a molecular weight of 473.44 g/mol. Its IUPAC name is 2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate |
| PubChem CID | 178001694 |
| Molecular Formula | C19H29BrN2O5Si |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)N1CCC(CCOc2cc([N+](=O)[O-])ccc2Br)CC1 |
| InChI | InChI=1S/C19H29BrN2O5Si/c1-28(2,3)13-12-27-19(23)21-9-6-15(7-10-21)8-11-26-18-14-16(22(24)25)4-5-17(18)20/h4-5,14-15H,6-13H2,1-3H3 |
| InChIKey | FABZUKHKPSIIAB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate?
The IUPAC name of 2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate (CID 178001694) is 2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate.
What is the SMILES notation for 2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate?
The canonical SMILES for 2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate is C[Si](C)(C)CCOC(=O)N1CCC(CCOc2cc([N+](=O)[O-])ccc2Br)CC1.
What is the InChIKey of 2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate?
The InChIKey is FABZUKHKPSIIAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29BrN2O5Si/c1-28(2,3)13-12-27-19(23)21-9-6-15(7-10-21)8-11-26-18-14-16(22(24)25)4-5-17(18)20/h4-5,14-15H,6-13H2,1-3H3.
What are the key properties of 2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate?
2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate has a molecular weight of 473.44 g/mol, XLogP of 5.31, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 4-[2-(2-bromo-5-nitrophenoxy)ethyl]piperidine-1-carboxylate is sourced from PubChem (CID 178001694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).