C13H19BrN2O4Si — CID 25232597
2-trimethylsilylethyl N-[(2-bromo-5-nitrophenyl)methyl]carbamate (PubChem CID 25232597) has the molecular formula C13H19BrN2O4Si and a molecular weight of 375.30 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[(2-bromo-5-nitrophenyl)methyl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[(2-bromo-5-nitrophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 25232597 |
| Molecular Formula | C13H19BrN2O4Si |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 2-trimethylsilylethyl N-[(2-bromo-5-nitrophenyl)methyl]carbamate |
| SMILES | C[Si](C)(C)CCOC(=O)NCc1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C13H19BrN2O4Si/c1-21(2,3)7-6-20-13(17)15-9-10-8-11(16(18)19)4-5-12(10)14/h4-5,8H,6-7,9H2,1-3H3,(H,15,17) |
| InChIKey | QOFDGTXIZZGOTF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|