C13H20BrNO3Si — CID 171525659
2-trimethylsilylethyl N-[(4-bromo-2-hydroxyphenyl)methyl]carbamate (PubChem CID 171525659) has the molecular formula C13H20BrNO3Si and a molecular weight of 346.30 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[(4-bromo-2-hydroxyphenyl)methyl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[(4-bromo-2-hydroxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 171525659 |
| Molecular Formula | C13H20BrNO3Si |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-trimethylsilylethyl N-[(4-bromo-2-hydroxyphenyl)methyl]carbamate |
| SMILES | C[Si](C)(C)CCOC(=O)NCc1ccc(Br)cc1O |
| InChI | InChI=1S/C13H20BrNO3Si/c1-19(2,3)7-6-18-13(17)15-9-10-4-5-11(14)8-12(10)16/h4-5,8,16H,6-7,9H2,1-3H3,(H,15,17) |
| InChIKey | IBHTYSORSLDHIE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|