C16H23BrN2O5 — CID 168824516
tert-butyl N-[4-[(2-bromo-5-nitrophenyl)methoxy]butyl]carbamate (PubChem CID 168824516) has the molecular formula C16H23BrN2O5 and a molecular weight of 403.27 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-bromo-5-nitrophenyl)methoxy]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-bromo-5-nitrophenyl)methoxy]butyl]carbamate |
|---|---|
| PubChem CID | 168824516 |
| Molecular Formula | C16H23BrN2O5 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | tert-butyl N-[4-[(2-bromo-5-nitrophenyl)methoxy]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCOCc1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C16H23BrN2O5/c1-16(2,3)24-15(20)18-8-4-5-9-23-11-12-10-13(19(21)22)6-7-14(12)17/h6-7,10H,4-5,8-9,11H2,1-3H3,(H,18,20) |
| InChIKey | OSNFQRHVBGNFPR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|