C16H21N3O4 — CID 129185889
tert-butyl N-[3-(5-nitroindol-1-yl)propyl]carbamate (PubChem CID 129185889) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is tert-butyl N-[3-(5-nitroindol-1-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-nitroindol-1-yl)propyl]carbamate |
|---|---|
| PubChem CID | 129185889 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | tert-butyl N-[3-(5-nitroindol-1-yl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCn1ccc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H21N3O4/c1-16(2,3)23-15(20)17-8-4-9-18-10-7-12-11-13(19(21)22)5-6-14(12)18/h5-7,10-11H,4,8-9H2,1-3H3,(H,17,20) |
| InChIKey | PDNXIGRFPQPISR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|