C16H19N3O2 — CID 106714558
2,2-dimethyl-6-(6-nitroindol-1-yl)hexanenitrile (PubChem CID 106714558) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2,2-dimethyl-6-(6-nitroindol-1-yl)hexanenitrile.
| Compound Name | 2,2-dimethyl-6-(6-nitroindol-1-yl)hexanenitrile |
|---|---|
| PubChem CID | 106714558 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2,2-dimethyl-6-(6-nitroindol-1-yl)hexanenitrile |
| SMILES | CC(C)(C#N)CCCCn1ccc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H19N3O2/c1-16(2,12-17)8-3-4-9-18-10-7-13-5-6-14(19(20)21)11-15(13)18/h5-7,10-11H,3-4,8-9H2,1-2H3 |
| InChIKey | CEBBLUMATTWHJI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|