C15H17N3O2 — CID 116621000
2,2-dimethyl-5-(6-nitroindol-1-yl)pentanenitrile (PubChem CID 116621000) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2,2-dimethyl-5-(6-nitroindol-1-yl)pentanenitrile.
| Compound Name | 2,2-dimethyl-5-(6-nitroindol-1-yl)pentanenitrile |
|---|---|
| PubChem CID | 116621000 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2,2-dimethyl-5-(6-nitroindol-1-yl)pentanenitrile |
| SMILES | CC(C)(C#N)CCCn1ccc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C15H17N3O2/c1-15(2,11-16)7-3-8-17-9-6-12-4-5-13(18(19)20)10-14(12)17/h4-6,9-10H,3,7-8H2,1-2H3 |
| InChIKey | PCRZIUOBIHDUAB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|