About 1-ethylindol-6-amine;1-ethyl-6-nitroindole
1-ethylindol-6-amine;1-ethyl-6-nitroindole (PubChem CID 159386864) has the molecular formula C20H22N4O2
and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-ethylindol-6-amine;1-ethyl-6-nitroindole.
Molecular Properties
| Compound Name | 1-ethylindol-6-amine;1-ethyl-6-nitroindole |
| PubChem CID | 159386864 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-ethylindol-6-amine;1-ethyl-6-nitroindole |
| SMILES | CCn1ccc2ccc(N)cc21.CCn1ccc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C10H10N2O2.C10H12N2/c1-2-11-6-5-8-3-4-9(12(13)14)7-10(8)11;1-2-12-6-5-8-3-4-9(11)7-10(8)12/h3-7H,2H2,1H3;3-7H,2,11H2,1H3 |
| InChIKey | LLPKGNGARPEXRY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylindol-6-amine;1-ethyl-6-nitroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylindol-6-amine;1-ethyl-6-nitroindole?
The IUPAC name of 1-ethylindol-6-amine;1-ethyl-6-nitroindole (CID 159386864) is 1-ethylindol-6-amine;1-ethyl-6-nitroindole.
What is the SMILES notation for 1-ethylindol-6-amine;1-ethyl-6-nitroindole?
The canonical SMILES for 1-ethylindol-6-amine;1-ethyl-6-nitroindole is CCn1ccc2ccc(N)cc21.CCn1ccc2ccc([N+](=O)[O-])cc21.
What is the InChIKey of 1-ethylindol-6-amine;1-ethyl-6-nitroindole?
The InChIKey is LLPKGNGARPEXRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2.C10H12N2/c1-2-11-6-5-8-3-4-9(12(13)14)7-10(8)11;1-2-12-6-5-8-3-4-9(11)7-10(8)12/h3-7H,2H2,1H3;3-7H,2,11H2,1H3.
What are the key properties of 1-ethylindol-6-amine;1-ethyl-6-nitroindole?
1-ethylindol-6-amine;1-ethyl-6-nitroindole has a molecular weight of 350.42 g/mol, XLogP of 4.81, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylindol-6-amine;1-ethyl-6-nitroindole is sourced from PubChem (CID 159386864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).