About tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen
tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen (PubChem CID 158779488) has the molecular formula C26H32N4O6
and a molecular weight of 496.56 g/mol. Its IUPAC name is tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen.
Molecular Properties
| Compound Name | tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen |
| PubChem CID | 158779488 |
| Molecular Formula | C26H32N4O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen |
| SMILES | CC(C)(C)OC(=O)n1ccc2ccc(N)cc21.CC(C)(C)OC(=O)n1ccc2ccc([N+](=O)[O-])cc21.[H][H] |
| InChI | InChI=1S/C13H14N2O4.C13H16N2O2.H2/c1-13(2,3)19-12(16)14-7-6-9-4-5-10(15(17)18)8-11(9)14;1-13(2,3)17-12(16)15-7-6-9-4-5-10(14)8-11(9)15;/h4-8H,1-3H3;4-8H,14H2,1-3H3;1H |
| InChIKey | IQWSOVSFCFOHRW-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen?
The IUPAC name of tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen (CID 158779488) is tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen.
What is the SMILES notation for tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen?
The canonical SMILES for tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen is CC(C)(C)OC(=O)n1ccc2ccc(N)cc21.CC(C)(C)OC(=O)n1ccc2ccc([N+](=O)[O-])cc21.[H][H].
What is the InChIKey of tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen?
The InChIKey is IQWSOVSFCFOHRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4.C13H16N2O2.H2/c1-13(2,3)19-12(16)14-7-6-9-4-5-10(15(17)18)8-11(9)14;1-13(2,3)17-12(16)15-7-6-9-4-5-10(14)8-11(9)15;/h4-8H,1-3H3;4-8H,14H2,1-3H3;1H.
What are the key properties of tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen?
tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen has a molecular weight of 496.56 g/mol, XLogP of 6.59, 1 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-aminoindole-1-carboxylate;tert-butyl 6-nitroindole-1-carboxylate;molecular hydrogen is sourced from PubChem (CID 158779488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).