C31H32N4O6 — CID 18373163
tert-butyl 6-[[2-[(4-tert-butylbenzoyl)amino]-5-nitrobenzoyl]amino]indole-1-carboxylate (PubChem CID 18373163) has the molecular formula C31H32N4O6 and a molecular weight of 556.62 g/mol. Its IUPAC name is tert-butyl 6-[[2-[(4-tert-butylbenzoyl)amino]-5-nitrobenzoyl]amino]indole-1-carboxylate.
| Compound Name | tert-butyl 6-[[2-[(4-tert-butylbenzoyl)amino]-5-nitrobenzoyl]amino]indole-1-carboxylate |
|---|---|
| PubChem CID | 18373163 |
| Molecular Formula | C31H32N4O6 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | tert-butyl 6-[[2-[(4-tert-butylbenzoyl)amino]-5-nitrobenzoyl]amino]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc2ccc(NC(=O)c3cc([N+](=O)[O-])ccc3NC(=O)c3ccc(C(C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C31H32N4O6/c1-30(2,3)21-10-7-20(8-11-21)27(36)33-25-14-13-23(35(39)40)18-24(25)28(37)32-22-12-9-19-15-16-34(26(19)17-22)29(38)41-31(4,5)6/h7-18H,1-6H3,(H,32,37)(H,33,36) |
| InChIKey | WHXCSXJCWALICD-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 132.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|