C30H31N5O6 — CID 70067994
tert-butyl 6-[[2-[(4-tert-butylbenzoyl)amino]-4-nitrobenzoyl]amino]-1H-indazole-3-carboxylate (PubChem CID 70067994) has the molecular formula C30H31N5O6 and a molecular weight of 557.61 g/mol. Its IUPAC name is tert-butyl 6-[[2-[(4-tert-butylbenzoyl)amino]-4-nitrobenzoyl]amino]-1H-indazole-3-carboxylate.
| Compound Name | tert-butyl 6-[[2-[(4-tert-butylbenzoyl)amino]-4-nitrobenzoyl]amino]-1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 70067994 |
| Molecular Formula | C30H31N5O6 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | tert-butyl 6-[[2-[(4-tert-butylbenzoyl)amino]-4-nitrobenzoyl]amino]-1H-indazole-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1n[nH]c2cc(NC(=O)c3ccc([N+](=O)[O-])cc3NC(=O)c3ccc(C(C)(C)C)cc3)ccc12 |
| InChI | InChI=1S/C30H31N5O6/c1-29(2,3)18-9-7-17(8-10-18)26(36)32-23-16-20(35(39)40)12-14-22(23)27(37)31-19-11-13-21-24(15-19)33-34-25(21)28(38)41-30(4,5)6/h7-16H,1-6H3,(H,31,37)(H,32,36)(H,33,34) |
| InChIKey | GHLYEQZFWDCKBI-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 156.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|