C20H22N4O4 — CID 70068484
tert-butyl 6-[(2-amino-3-methoxybenzoyl)amino]-1H-indazole-3-carboxylate (PubChem CID 70068484) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is tert-butyl 6-[(2-amino-3-methoxybenzoyl)amino]-1H-indazole-3-carboxylate.
| Compound Name | tert-butyl 6-[(2-amino-3-methoxybenzoyl)amino]-1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 70068484 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | tert-butyl 6-[(2-amino-3-methoxybenzoyl)amino]-1H-indazole-3-carboxylate |
| SMILES | COc1cccc(C(=O)Nc2ccc3c(C(=O)OC(C)(C)C)n[nH]c3c2)c1N |
| InChI | InChI=1S/C20H22N4O4/c1-20(2,3)28-19(26)17-12-9-8-11(10-14(12)23-24-17)22-18(25)13-6-5-7-15(27-4)16(13)21/h5-10H,21H2,1-4H3,(H,22,25)(H,23,24) |
| InChIKey | JWGAISFOWVOLFD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|