C19H25N3O4 — CID 68669952
tert-butyl 4-[(5-nitroindol-1-yl)methyl]piperidine-1-carboxylate (PubChem CID 68669952) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is tert-butyl 4-[(5-nitroindol-1-yl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5-nitroindol-1-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68669952 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | tert-butyl 4-[(5-nitroindol-1-yl)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cn2ccc3cc([N+](=O)[O-])ccc32)CC1 |
| InChI | InChI=1S/C19H25N3O4/c1-19(2,3)26-18(23)20-9-6-14(7-10-20)13-21-11-8-15-12-16(22(24)25)4-5-17(15)21/h4-5,8,11-12,14H,6-7,9-10,13H2,1-3H3 |
| InChIKey | XZHVRTKBVWONTP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 77.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|