C19H22N4O4 — CID 86708640
tert-butyl 4-(3-cyano-5-nitroindol-1-yl)piperidine-1-carboxylate (PubChem CID 86708640) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is tert-butyl 4-(3-cyano-5-nitroindol-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-cyano-5-nitroindol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86708640 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | tert-butyl 4-(3-cyano-5-nitroindol-1-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(C#N)c3cc([N+](=O)[O-])ccc32)CC1 |
| InChI | InChI=1S/C19H22N4O4/c1-19(2,3)27-18(24)21-8-6-14(7-9-21)22-12-13(11-20)16-10-15(23(25)26)4-5-17(16)22/h4-5,10,12,14H,6-9H2,1-3H3 |
| InChIKey | AYHIRLNQIZRDET-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 101.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|