C18H25BN2O5 — CID 175503575
[1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]indol-3-yl]oxyboronic acid (PubChem CID 175503575) has the molecular formula C18H25BN2O5 and a molecular weight of 360.22 g/mol. Its IUPAC name is [1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]indol-3-yl]oxyboronic acid.
| Compound Name | [1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]indol-3-yl]oxyboronic acid |
|---|---|
| PubChem CID | 175503575 |
| Molecular Formula | C18H25BN2O5 |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]indol-3-yl]oxyboronic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(OB(O)O)c3ccccc32)CC1 |
| InChI | InChI=1S/C18H25BN2O5/c1-18(2,3)25-17(22)20-10-8-13(9-11-20)21-12-16(26-19(23)24)14-6-4-5-7-15(14)21/h4-7,12-13,23-24H,8-11H2,1-3H3 |
| InChIKey | SNSFHYLWZUHUQG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|