C18H24BrN3O2 — CID 178042915
tert-butyl 4-(3-bromoindazol-1-yl)azepane-1-carboxylate (PubChem CID 178042915) has the molecular formula C18H24BrN3O2 and a molecular weight of 394.31 g/mol. Its IUPAC name is tert-butyl 4-(3-bromoindazol-1-yl)azepane-1-carboxylate.
| Compound Name | tert-butyl 4-(3-bromoindazol-1-yl)azepane-1-carboxylate |
|---|---|
| PubChem CID | 178042915 |
| Molecular Formula | C18H24BrN3O2 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | tert-butyl 4-(3-bromoindazol-1-yl)azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(n2nc(Br)c3ccccc32)CC1 |
| InChI | InChI=1S/C18H24BrN3O2/c1-18(2,3)24-17(23)21-11-6-7-13(10-12-21)22-15-9-5-4-8-14(15)16(19)20-22/h4-5,8-9,13H,6-7,10-12H2,1-3H3 |
| InChIKey | LXVGAQOTHZFRNB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |