C19H28BrN3O2 — CID 171544267
tert-butyl 3-(3-bromoindazol-1-yl)piperidine-1-carboxylate;ethane (PubChem CID 171544267) has the molecular formula C19H28BrN3O2 and a molecular weight of 410.36 g/mol. Its IUPAC name is tert-butyl 3-(3-bromoindazol-1-yl)piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-(3-bromoindazol-1-yl)piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 171544267 |
| Molecular Formula | C19H28BrN3O2 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | tert-butyl 3-(3-bromoindazol-1-yl)piperidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCCC(n2nc(Br)c3ccccc32)C1 |
| InChI | InChI=1S/C17H22BrN3O2.C2H6/c1-17(2,3)23-16(22)20-10-6-7-12(11-20)21-14-9-5-4-8-13(14)15(18)19-21;1-2/h4-5,8-9,12H,6-7,10-11H2,1-3H3;1-2H3 |
| InChIKey | ATYFKTZSYNWPNZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |