C17H22BrN3O2 — CID 175058391
tert-butyl 3-(5-bromoindazol-2-yl)piperidine-1-carboxylate (PubChem CID 175058391) has the molecular formula C17H22BrN3O2 and a molecular weight of 380.29 g/mol. Its IUPAC name is tert-butyl 3-(5-bromoindazol-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(5-bromoindazol-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175058391 |
| Molecular Formula | C17H22BrN3O2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | tert-butyl 3-(5-bromoindazol-2-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(n2cc3cc(Br)ccc3n2)C1 |
| InChI | InChI=1S/C17H22BrN3O2/c1-17(2,3)23-16(22)20-8-4-5-14(11-20)21-10-12-9-13(18)6-7-15(12)19-21/h6-7,9-10,14H,4-5,8,11H2,1-3H3 |
| InChIKey | NVSOAYIUWJEIST-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |