C18H34N4O3 — CID 144571732
tert-butyl 3-(4-carbamoyl-3-methylpyrazol-1-yl)piperidine-1-carboxylate;ethane;methane (PubChem CID 144571732) has the molecular formula C18H34N4O3 and a molecular weight of 354.50 g/mol. Its IUPAC name is tert-butyl 3-(4-carbamoyl-3-methylpyrazol-1-yl)piperidine-1-carboxylate;ethane;methane.
| Compound Name | tert-butyl 3-(4-carbamoyl-3-methylpyrazol-1-yl)piperidine-1-carboxylate;ethane;methane |
|---|---|
| PubChem CID | 144571732 |
| Molecular Formula | C18H34N4O3 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | tert-butyl 3-(4-carbamoyl-3-methylpyrazol-1-yl)piperidine-1-carboxylate;ethane;methane |
| SMILES | C.CC.Cc1nn(C2CCCN(C(=O)OC(C)(C)C)C2)cc1C(N)=O |
| InChI | InChI=1S/C15H24N4O3.C2H6.CH4/c1-10-12(13(16)20)9-19(17-10)11-6-5-7-18(8-11)14(21)22-15(2,3)4;1-2;/h9,11H,5-8H2,1-4H3,(H2,16,20);1-2H3;1H4 |
| InChIKey | SBNPQHZMVOFTCB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |