C17H29N3O2 — CID 170927522
tert-butyl (3R)-3-(4-tert-butylpyrazol-1-yl)piperidine-1-carboxylate (PubChem CID 170927522) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is tert-butyl (3R)-3-(4-tert-butylpyrazol-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(4-tert-butylpyrazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170927522 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | tert-butyl (3R)-3-(4-tert-butylpyrazol-1-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](n2cc(C(C)(C)C)cn2)C1 |
| InChI | InChI=1S/C17H29N3O2/c1-16(2,3)13-10-18-20(11-13)14-8-7-9-19(12-14)15(21)22-17(4,5)6/h10-11,14H,7-9,12H2,1-6H3/t14-/m1/s1 |
| InChIKey | MNYYLAJPBAXDBP-CQSZACIVSA-N |
| XLogP | 3.75 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |