C14H24N4O4 — CID 156721962
tert-butyl 3-(4-nitropyrazol-1-yl)pyrrolidine-1-carboxylate;ethane (PubChem CID 156721962) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is tert-butyl 3-(4-nitropyrazol-1-yl)pyrrolidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-(4-nitropyrazol-1-yl)pyrrolidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 156721962 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | tert-butyl 3-(4-nitropyrazol-1-yl)pyrrolidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCC(n2cc([N+](=O)[O-])cn2)C1 |
| InChI | InChI=1S/C12H18N4O4.C2H6/c1-12(2,3)20-11(17)14-5-4-9(7-14)15-8-10(6-13-15)16(18)19;1-2/h6,8-9H,4-5,7H2,1-3H3;1-2H3 |
| InChIKey | UOAJXWBYQNQQQR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|