C14H22N4O4 — CID 118288867
tert-butyl (3S)-3-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate (PubChem CID 118288867) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is tert-butyl (3S)-3-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118288867 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | tert-butyl (3S)-3-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate |
| SMILES | Cc1c([N+](=O)[O-])cnn1[C@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H22N4O4/c1-10-12(18(20)21)8-15-17(10)11-6-5-7-16(9-11)13(19)22-14(2,3)4/h8,11H,5-7,9H2,1-4H3/t11-/m0/s1 |
| InChIKey | AEHQCQMRMUZEBL-NSHDSACASA-N |
| XLogP | 2.67 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|