C14H24N4O4 — CID 174819152
tert-butyl formate;(3R)-3-(5-methyl-4-nitropyrazol-1-yl)piperidine (PubChem CID 174819152) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is tert-butyl formate;(3R)-3-(5-methyl-4-nitropyrazol-1-yl)piperidine.
| Compound Name | tert-butyl formate;(3R)-3-(5-methyl-4-nitropyrazol-1-yl)piperidine |
|---|---|
| PubChem CID | 174819152 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | tert-butyl formate;(3R)-3-(5-methyl-4-nitropyrazol-1-yl)piperidine |
| SMILES | CC(C)(C)OC=O.Cc1c([N+](=O)[O-])cnn1[C@@H]1CCCNC1 |
| InChI | InChI=1S/C9H14N4O2.C5H10O2/c1-7-9(13(14)15)6-11-12(7)8-3-2-4-10-5-8;1-5(2,3)7-4-6/h6,8,10H,2-5H2,1H3;4H,1-3H3/t8-;/m1./s1 |
| InChIKey | KZGPSFOGTPOOAW-DDWIOCJRSA-N |
| XLogP | 1.98 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|