C16H25N3O5 — CID 175294004
tert-butyl formate;3-nitro-4-(piperidin-4-ylmethoxy)pyridine (PubChem CID 175294004) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is tert-butyl formate;3-nitro-4-(piperidin-4-ylmethoxy)pyridine.
| Compound Name | tert-butyl formate;3-nitro-4-(piperidin-4-ylmethoxy)pyridine |
|---|---|
| PubChem CID | 175294004 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | tert-butyl formate;3-nitro-4-(piperidin-4-ylmethoxy)pyridine |
| SMILES | CC(C)(C)OC=O.O=[N+]([O-])c1cnccc1OCC1CCNCC1 |
| InChI | InChI=1S/C11H15N3O3.C5H10O2/c15-14(16)10-7-13-6-3-11(10)17-8-9-1-4-12-5-2-9;1-5(2,3)7-4-6/h3,6-7,9,12H,1-2,4-5,8H2;4H,1-3H3 |
| InChIKey | DMHBHJVYVDIAKQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|