C16H23N3O5 — CID 175294003
[4-[(3-nitro-4-pyridinyl)oxymethyl]piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 175294003) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is [4-[(3-nitro-4-pyridinyl)oxymethyl]piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(3-nitro-4-pyridinyl)oxymethyl]piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175294003 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | [4-[(3-nitro-4-pyridinyl)oxymethyl]piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC(COc2ccncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H23N3O5/c1-16(2,3)15(20)24-18-8-5-12(6-9-18)11-23-14-4-7-17-10-13(14)19(21)22/h4,7,10,12H,5-6,8-9,11H2,1-3H3 |
| InChIKey | MCAMIEMJCACISC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|