C13H19ClN4O4 — CID 175301646
[(3S)-3-(5-chloro-4-nitropyrazol-1-yl)piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 175301646) has the molecular formula C13H19ClN4O4 and a molecular weight of 330.77 g/mol. Its IUPAC name is [(3S)-3-(5-chloro-4-nitropyrazol-1-yl)piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3S)-3-(5-chloro-4-nitropyrazol-1-yl)piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175301646 |
| Molecular Formula | C13H19ClN4O4 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | [(3S)-3-(5-chloro-4-nitropyrazol-1-yl)piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC[C@H](n2ncc([N+](=O)[O-])c2Cl)C1 |
| InChI | InChI=1S/C13H19ClN4O4/c1-13(2,3)12(19)22-16-6-4-5-9(8-16)17-11(14)10(7-15-17)18(20)21/h7,9H,4-6,8H2,1-3H3/t9-/m0/s1 |
| InChIKey | FMXBGERMWZFEJR-VIFPVBQESA-N |
| XLogP | 2.59 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|