C16H23N5O5 — CID 171506559
tert-butyl 5-[4-nitro-1-(oxetan-3-yl)pyrazol-5-yl]-2,5-diazabicyclo[4.1.0]heptane-2-carboxylate (PubChem CID 171506559) has the molecular formula C16H23N5O5 and a molecular weight of 365.39 g/mol. Its IUPAC name is tert-butyl 5-[4-nitro-1-(oxetan-3-yl)pyrazol-5-yl]-2,5-diazabicyclo[4.1.0]heptane-2-carboxylate.
| Compound Name | tert-butyl 5-[4-nitro-1-(oxetan-3-yl)pyrazol-5-yl]-2,5-diazabicyclo[4.1.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 171506559 |
| Molecular Formula | C16H23N5O5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | tert-butyl 5-[4-nitro-1-(oxetan-3-yl)pyrazol-5-yl]-2,5-diazabicyclo[4.1.0]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2c([N+](=O)[O-])cnn2C2COC2)C2CC21 |
| InChI | InChI=1S/C16H23N5O5/c1-16(2,3)26-15(22)19-5-4-18(11-6-12(11)19)14-13(21(23)24)7-17-20(14)10-8-25-9-10/h7,10-12H,4-6,8-9H2,1-3H3 |
| InChIKey | ZNWKTMKXPQRDME-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 102.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|