C14H21FN4O4 — CID 118288730
tert-butyl 3-fluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate (PubChem CID 118288730) has the molecular formula C14H21FN4O4 and a molecular weight of 328.34 g/mol. Its IUPAC name is tert-butyl 3-fluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-fluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118288730 |
| Molecular Formula | C14H21FN4O4 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | tert-butyl 3-fluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate |
| SMILES | Cc1c([N+](=O)[O-])cnn1C1CCN(C(=O)OC(C)(C)C)CC1F |
| InChI | InChI=1S/C14H21FN4O4/c1-9-12(19(21)22)7-16-18(9)11-5-6-17(8-10(11)15)13(20)23-14(2,3)4/h7,10-11H,5-6,8H2,1-4H3 |
| InChIKey | FERPMNAOMKPJET-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|