C11H17FN4O — CID 146552640
1-[(3S)-4-(4-amino-5-methylpyrazol-1-yl)-3-fluoropiperidin-1-yl]ethanone (PubChem CID 146552640) has the molecular formula C11H17FN4O and a molecular weight of 240.28 g/mol. Its IUPAC name is 1-[(3S)-4-(4-amino-5-methylpyrazol-1-yl)-3-fluoropiperidin-1-yl]ethanone.
| Compound Name | 1-[(3S)-4-(4-amino-5-methylpyrazol-1-yl)-3-fluoropiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 146552640 |
| Molecular Formula | C11H17FN4O |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-[(3S)-4-(4-amino-5-methylpyrazol-1-yl)-3-fluoropiperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(n2ncc(N)c2C)[C@@H](F)C1 |
| InChI | InChI=1S/C11H17FN4O/c1-7-10(13)5-14-16(7)11-3-4-15(8(2)17)6-9(11)12/h5,9,11H,3-4,6,13H2,1-2H3/t9-,11?/m0/s1 |
| InChIKey | KRKAPAKSIOAINV-FTNKSUMCSA-N |
| XLogP | 0.91 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |