C15H21FN4O4 — CID 118288856
tert-butyl 4-(5-ethenyl-4-nitropyrazol-1-yl)-3-fluoropiperidine-1-carboxylate (PubChem CID 118288856) has the molecular formula C15H21FN4O4 and a molecular weight of 340.36 g/mol. Its IUPAC name is tert-butyl 4-(5-ethenyl-4-nitropyrazol-1-yl)-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-ethenyl-4-nitropyrazol-1-yl)-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 118288856 |
| Molecular Formula | C15H21FN4O4 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | tert-butyl 4-(5-ethenyl-4-nitropyrazol-1-yl)-3-fluoropiperidine-1-carboxylate |
| SMILES | C=Cc1c([N+](=O)[O-])cnn1C1CCN(C(=O)OC(C)(C)C)CC1F |
| InChI | InChI=1S/C15H21FN4O4/c1-5-11-13(20(22)23)8-17-19(11)12-6-7-18(9-10(12)16)14(21)24-15(2,3)4/h5,8,10,12H,1,6-7,9H2,2-4H3 |
| InChIKey | LFRIPWLBCXVSIP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|