C12H21FN2O3 — CID 171487599
tert-butyl 3-fluoro-4-(methylcarbamoyl)piperidine-1-carboxylate (PubChem CID 171487599) has the molecular formula C12H21FN2O3 and a molecular weight of 260.31 g/mol. Its IUPAC name is tert-butyl 3-fluoro-4-(methylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-fluoro-4-(methylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171487599 |
| Molecular Formula | C12H21FN2O3 |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | tert-butyl 3-fluoro-4-(methylcarbamoyl)piperidine-1-carboxylate |
| SMILES | CNC(=O)C1CCN(C(=O)OC(C)(C)C)CC1F |
| InChI | InChI=1S/C12H21FN2O3/c1-12(2,3)18-11(17)15-6-5-8(9(13)7-15)10(16)14-4/h8-9H,5-7H2,1-4H3,(H,14,16) |
| InChIKey | JICBHCFBZCEQIJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |