C11H22FN3O2 — CID 170194480
tert-butyl (3S)-3-fluoro-4-(2-methylhydrazinyl)piperidine-1-carboxylate (PubChem CID 170194480) has the molecular formula C11H22FN3O2 and a molecular weight of 247.31 g/mol. Its IUPAC name is tert-butyl (3S)-3-fluoro-4-(2-methylhydrazinyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-fluoro-4-(2-methylhydrazinyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170194480 |
| Molecular Formula | C11H22FN3O2 |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | tert-butyl (3S)-3-fluoro-4-(2-methylhydrazinyl)piperidine-1-carboxylate |
| SMILES | CNNC1CCN(C(=O)OC(C)(C)C)C[C@@H]1F |
| InChI | InChI=1S/C11H22FN3O2/c1-11(2,3)17-10(16)15-6-5-9(14-13-4)8(12)7-15/h8-9,13-14H,5-7H2,1-4H3/t8-,9?/m0/s1 |
| InChIKey | XQVOVMIEPLSZPJ-IENPIDJESA-N |
| XLogP | 1.06 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|