C11H17F4NO5S — CID 89088003
tert-butyl (3R,4R)-3-fluoro-4-(trifluoromethylsulfonyloxy)piperidine-1-carboxylate (PubChem CID 89088003) has the molecular formula C11H17F4NO5S and a molecular weight of 351.32 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-fluoro-4-(trifluoromethylsulfonyloxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-fluoro-4-(trifluoromethylsulfonyloxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89088003 |
| Molecular Formula | C11H17F4NO5S |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | tert-butyl (3R,4R)-3-fluoro-4-(trifluoromethylsulfonyloxy)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](OS(=O)(=O)C(F)(F)F)[C@H](F)C1 |
| InChI | InChI=1S/C11H17F4NO5S/c1-10(2,3)20-9(17)16-5-4-8(7(12)6-16)21-22(18,19)11(13,14)15/h7-8H,4-6H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | HGQMMDWFYACZPO-HTQZYQBOSA-N |
| XLogP | 2.20 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|